About ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol
ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol (PubChem CID 145169284) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
Molecular Properties
| Compound Name | ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| PubChem CID | 145169284 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC.OCC1C=CC=CC1O |
| InChI | InChI=1S/C7H10O2.C2H6/c8-5-6-3-1-2-4-7(6)9;1-2/h1-4,6-9H,5H2;1-2H3 |
| InChIKey | IGNURORGVNGPNF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The IUPAC name of ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol (CID 145169284) is ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol.
What is the SMILES notation for ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The canonical SMILES for ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol is CC.OCC1C=CC=CC1O.
What is the InChIKey of ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
The InChIKey is IGNURORGVNGPNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O2.C2H6/c8-5-6-3-1-2-4-7(6)9;1-2/h1-4,6-9H,5H2;1-2H3.
What are the key properties of ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol?
ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol has a molecular weight of 156.22 g/mol, XLogP of 1.11, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;6-(hydroxymethyl)cyclohexa-2,4-dien-1-ol is sourced from PubChem (CID 145169284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).