C28H43N3O2 — CID 145169302
ethane;4-[4-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]piperidin-1-yl]cyclohexan-1-ol;prop-1-ene (PubChem CID 145169302) has the molecular formula C28H43N3O2 and a molecular weight of 453.67 g/mol. Its IUPAC name is ethane;4-[4-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]piperidin-1-yl]cyclohexan-1-ol;prop-1-ene.
| Compound Name | ethane;4-[4-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]piperidin-1-yl]cyclohexan-1-ol;prop-1-ene |
|---|---|
| PubChem CID | 145169302 |
| Molecular Formula | C28H43N3O2 |
| Molecular Weight | 453.67 g/mol |
| Exact Mass | 453.34 |
| IUPAC Name | ethane;4-[4-[1-hydroxy-2-(5H-imidazo[5,1-a]isoindol-5-yl)ethyl]piperidin-1-yl]cyclohexan-1-ol;prop-1-ene |
| SMILES | C=CC.CC.OC1CCC(N2CCC(C(O)CC3c4ccccc4-c4cncn43)CC2)CC1 |
| InChI | InChI=1S/C23H31N3O2.C3H6.C2H6/c27-18-7-5-17(6-8-18)25-11-9-16(10-12-25)23(28)13-21-19-3-1-2-4-20(19)22-14-24-15-26(21)22;1-3-2;1-2/h1-4,14-18,21,23,27-28H,5-13H2;3H,1H2,2H3;1-2H3 |
| InChIKey | FUXAIOZMEPRMGN-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 61.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|