About N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene
N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene (PubChem CID 145169801) has the molecular formula C13H22N4
and a molecular weight of 234.35 g/mol. Its IUPAC name is N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene.
Molecular Properties
| Compound Name | N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene |
| PubChem CID | 145169801 |
| Molecular Formula | C13H22N4 |
| Molecular Weight | 234.35 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene |
| SMILES | C=C(CC)/C(=N\C)Nc1cc(C)[nH]n1.C=CC |
| InChI | InChI=1S/C10H16N4.C3H6/c1-5-7(2)10(11-4)12-9-6-8(3)13-14-9;1-3-2/h6H,2,5H2,1,3-4H3,(H2,11,12,13,14);3H,1H2,2H3 |
| InChIKey | YNEYQLXESWVAPI-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.35 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene?
The IUPAC name of N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene (CID 145169801) is N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene.
What is the SMILES notation for N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene?
The canonical SMILES for N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene is C=C(CC)/C(=N\C)Nc1cc(C)[nH]n1.C=CC.
What is the InChIKey of N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene?
The InChIKey is YNEYQLXESWVAPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16N4.C3H6/c1-5-7(2)10(11-4)12-9-6-8(3)13-14-9;1-3-2/h6H,2,5H2,1,3-4H3,(H2,11,12,13,14);3H,1H2,2H3.
What are the key properties of N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene?
N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene has a molecular weight of 234.35 g/mol, XLogP of 3.32, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-methyl-2-methylidene-N-(5-methyl-1H-pyrazol-3-yl)butanimidamide;prop-1-ene is sourced from PubChem (CID 145169801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).