About CID 145169975
CID 145169975 (PubChem CID 145169975) has the molecular formula C51H33F3N2O4S4
and a molecular weight of 923.10 g/mol.
Molecular Properties
| Compound Name | CID 145169975 |
| PubChem CID | 145169975 |
| Molecular Formula | C51H33F3N2O4S4 |
| Molecular Weight | 923.10 g/mol |
| Exact Mass | 922.13 |
| IUPAC Name | — |
| SMILES | O=S(=O)(Oc1cc(N(c2ccc3ccccc3c2)c2ccc3oc4ccccc4c3c2)ccc1N(c1ccc2ccccc2c1)c1ccc2sc3ccccc3c2c1)C(F)(F)F.SS |
| InChI | InChI=1S/C51H31F3N2O4S2.H2S2/c52-51(53,54)62(57,58)60-48-31-40(55(36-19-17-32-9-1-3-11-34(32)27-36)38-22-25-47-43(29-38)41-13-5-7-15-46(41)59-47)21-24-45(48)56(37-20-18-33-10-2-4-12-35(33)28-37)39-23-26-50-44(30-39)42-14-6-8-16-49(42)61-50;1-2/h1-31H;1-2H |
| InChIKey | ASAJODICANVZJC-UHFFFAOYSA-N |
| XLogP | 16.19 |
| TPSA | 62.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 64 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 923.10 |
| LogP ≤ 5 | 16.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze CID 145169975 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 145169975?
The IUPAC name of CID 145169975 (CID 145169975) is not available.
What is the SMILES notation for CID 145169975?
The canonical SMILES for CID 145169975 is O=S(=O)(Oc1cc(N(c2ccc3ccccc3c2)c2ccc3oc4ccccc4c3c2)ccc1N(c1ccc2ccccc2c1)c1ccc2sc3ccccc3c2c1)C(F)(F)F.SS.
What is the InChIKey of CID 145169975?
The InChIKey is ASAJODICANVZJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C51H31F3N2O4S2.H2S2/c52-51(53,54)62(57,58)60-48-31-40(55(36-19-17-32-9-1-3-11-34(32)27-36)38-22-25-47-43(29-38)41-13-5-7-15-46(41)59-47)21-24-45(48)56(37-20-18-33-10-2-4-12-35(33)28-37)39-23-26-50-44(30-39)42-14-6-8-16-49(42)61-50;1-2/h1-31H;1-2H.
What are the key properties of CID 145169975?
CID 145169975 has a molecular weight of 923.10 g/mol, XLogP of 16.19, 8 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for CID 145169975 is sourced from PubChem (CID 145169975), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).