C22H25BOS — CID 145170085
4,4,5,5-tetramethyl-2-[8-[(E)-prop-1-enyl]dibenzothiophen-2-yl]oxaborolane (PubChem CID 145170085) has the molecular formula C22H25BOS and a molecular weight of 348.32 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-[8-[(E)-prop-1-enyl]dibenzothiophen-2-yl]oxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-[8-[(E)-prop-1-enyl]dibenzothiophen-2-yl]oxaborolane |
|---|---|
| PubChem CID | 145170085 |
| Molecular Formula | C22H25BOS |
| Molecular Weight | 348.32 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-[8-[(E)-prop-1-enyl]dibenzothiophen-2-yl]oxaborolane |
| SMILES | C/C=C/c1ccc2sc3ccc(B4CC(C)(C)C(C)(C)O4)cc3c2c1 |
| InChI | InChI=1S/C22H25BOS/c1-6-7-15-8-10-19-17(12-15)18-13-16(9-11-20(18)25-19)23-14-21(2,3)22(4,5)24-23/h6-13H,14H2,1-5H3/b7-6+ |
| InChIKey | PZAHZSGZMPFYQG-VOTSOKGWSA-N |
| XLogP | 6.12 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|