About 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene
1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene (PubChem CID 145170378) has the molecular formula C9H6Cl4
and a molecular weight of 255.96 g/mol. Its IUPAC name is 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene.
Molecular Properties
| Compound Name | 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene |
| PubChem CID | 145170378 |
| Molecular Formula | C9H6Cl4 |
| Molecular Weight | 255.96 g/mol |
| Exact Mass | 253.92 |
| IUPAC Name | 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene |
| SMILES | Clc1cc(Cl)cc(C2CC2(Cl)Cl)c1 |
| InChI | InChI=1S/C9H6Cl4/c10-6-1-5(2-7(11)3-6)8-4-9(8,12)13/h1-3,8H,4H2 |
| InChIKey | DGJDRIUKHWDQCY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.96 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene?
The IUPAC name of 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene (CID 145170378) is 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene.
What is the SMILES notation for 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene?
The canonical SMILES for 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene is Clc1cc(Cl)cc(C2CC2(Cl)Cl)c1.
What is the InChIKey of 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene?
The InChIKey is DGJDRIUKHWDQCY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H6Cl4/c10-6-1-5(2-7(11)3-6)8-4-9(8,12)13/h1-3,8H,4H2.
What are the key properties of 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene?
1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene has a molecular weight of 255.96 g/mol, XLogP of 4.65, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dichloro-5-(2,2-dichlorocyclopropyl)benzene is sourced from PubChem (CID 145170378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).