C24H26ClFN7O3S+ — CID 145170460
N,N'-diamino-N-[4-chloro-2-[6-[[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-hydroxymethyl]-1-hydroxy-5-propylpyridin-1-ium-3-yl]phenyl]methanimidamide (PubChem CID 145170460) has the molecular formula C24H26ClFN7O3S+ and a molecular weight of 547.04 g/mol. Its IUPAC name is N,N'-diamino-N-[4-chloro-2-[6-[[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-hydroxymethyl]-1-hydroxy-5-propylpyridin-1-ium-3-yl]phenyl]methanimidamide.
| Compound Name | N,N'-diamino-N-[4-chloro-2-[6-[[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-hydroxymethyl]-1-hydroxy-5-propylpyridin-1-ium-3-yl]phenyl]methanimidamide |
|---|---|
| PubChem CID | 145170460 |
| Molecular Formula | C24H26ClFN7O3S+ |
| Molecular Weight | 547.04 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | N,N'-diamino-N-[4-chloro-2-[6-[[5-[4-fluoro-5-(hydroxymethyl)thiophen-3-yl]-1H-imidazol-2-yl]-hydroxymethyl]-1-hydroxy-5-propylpyridin-1-ium-3-yl]phenyl]methanimidamide |
| SMILES | CCCc1cc(-c2cc(Cl)ccc2N(N)/C=N\N)c[n+](O)c1C(O)c1ncc(-c2csc(CO)c2F)[nH]1 |
| InChI | InChI=1S/C24H26ClFN7O3S/c1-2-3-13-6-14(16-7-15(25)4-5-19(16)32(28)12-30-27)9-33(36)22(13)23(35)24-29-8-18(31-24)17-11-37-20(10-34)21(17)26/h4-9,11-12,23,34-36H,2-3,10,27-28H2,1H3,(H,29,31)/q+1/b30-12- |
| InChIKey | ZYLSRSWLHLHYBF-FTCYSYDXSA-N |
| XLogP | 3.23 |
| TPSA | 160.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.04 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|