About bromobenzene;3-(4-methylphenyl)propanal
bromobenzene;3-(4-methylphenyl)propanal (PubChem CID 145170933) has the molecular formula C16H17BrO
and a molecular weight of 305.22 g/mol. Its IUPAC name is bromobenzene;3-(4-methylphenyl)propanal.
Molecular Properties
| Compound Name | bromobenzene;3-(4-methylphenyl)propanal |
| PubChem CID | 145170933 |
| Molecular Formula | C16H17BrO |
| Molecular Weight | 305.22 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | bromobenzene;3-(4-methylphenyl)propanal |
| SMILES | Brc1ccccc1.Cc1ccc(CCC=O)cc1 |
| InChI | InChI=1S/C10H12O.C6H5Br/c1-9-4-6-10(7-5-9)3-2-8-11;7-6-4-2-1-3-5-6/h4-8H,2-3H2,1H3;1-5H |
| InChIKey | NAZMKOTVEWMSRY-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.22 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze bromobenzene;3-(4-methylphenyl)propanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromobenzene;3-(4-methylphenyl)propanal?
The IUPAC name of bromobenzene;3-(4-methylphenyl)propanal (CID 145170933) is bromobenzene;3-(4-methylphenyl)propanal.
What is the SMILES notation for bromobenzene;3-(4-methylphenyl)propanal?
The canonical SMILES for bromobenzene;3-(4-methylphenyl)propanal is Brc1ccccc1.Cc1ccc(CCC=O)cc1.
What is the InChIKey of bromobenzene;3-(4-methylphenyl)propanal?
The InChIKey is NAZMKOTVEWMSRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12O.C6H5Br/c1-9-4-6-10(7-5-9)3-2-8-11;7-6-4-2-1-3-5-6/h4-8H,2-3H2,1H3;1-5H.
What are the key properties of bromobenzene;3-(4-methylphenyl)propanal?
bromobenzene;3-(4-methylphenyl)propanal has a molecular weight of 305.22 g/mol, XLogP of 4.58, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bromobenzene;3-(4-methylphenyl)propanal is sourced from PubChem (CID 145170933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).