About 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene
3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene (PubChem CID 145171017) has the molecular formula C24H27FN2O3
and a molecular weight of 410.49 g/mol. Its IUPAC name is 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene.
Molecular Properties
| Compound Name | 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene |
| PubChem CID | 145171017 |
| Molecular Formula | C24H27FN2O3 |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene |
| SMILES | CCOC(CCc1cccc(-c2ccncc2)c1)CC(=O)NO.Fc1ccccc1 |
| InChI | InChI=1S/C18H22N2O3.C6H5F/c1-2-23-17(13-18(21)20-22)7-6-14-4-3-5-16(12-14)15-8-10-19-11-9-15;7-6-4-2-1-3-5-6/h3-5,8-12,17,22H,2,6-7,13H2,1H3,(H,20,21);1-5H |
| InChIKey | AHHGBHQYIHELLR-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene?
The IUPAC name of 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene (CID 145171017) is 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene.
What is the SMILES notation for 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene?
The canonical SMILES for 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene is CCOC(CCc1cccc(-c2ccncc2)c1)CC(=O)NO.Fc1ccccc1.
What is the InChIKey of 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene?
The InChIKey is AHHGBHQYIHELLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H22N2O3.C6H5F/c1-2-23-17(13-18(21)20-22)7-6-14-4-3-5-16(12-14)15-8-10-19-11-9-15;7-6-4-2-1-3-5-6/h3-5,8-12,17,22H,2,6-7,13H2,1H3,(H,20,21);1-5H.
What are the key properties of 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene?
3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene has a molecular weight of 410.49 g/mol, XLogP of 4.81, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethoxy-N-hydroxy-5-(3-pyridin-4-ylphenyl)pentanamide;fluorobenzene is sourced from PubChem (CID 145171017), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).