C12H13F3O2S — CID 145171131
3-ethoxy-1,2,7-trifluoro-3-methoxy-1,2-dihydroindene-4-thiol (PubChem CID 145171131) has the molecular formula C12H13F3O2S and a molecular weight of 278.30 g/mol. Its IUPAC name is 3-ethoxy-1,2,7-trifluoro-3-methoxy-1,2-dihydroindene-4-thiol.
| Compound Name | 3-ethoxy-1,2,7-trifluoro-3-methoxy-1,2-dihydroindene-4-thiol |
|---|---|
| PubChem CID | 145171131 |
| Molecular Formula | C12H13F3O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 3-ethoxy-1,2,7-trifluoro-3-methoxy-1,2-dihydroindene-4-thiol |
| SMILES | CCOC1(OC)c2c(S)ccc(F)c2C(F)C1F |
| InChI | InChI=1S/C12H13F3O2S/c1-3-17-12(16-2)9-7(18)5-4-6(13)8(9)10(14)11(12)15/h4-5,10-11,18H,3H2,1-2H3 |
| InChIKey | LWCQKFMXHKAGLT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|