C23H26F2O3 — CID 145171203
(2E,4E)-5-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid;ethane (PubChem CID 145171203) has the molecular formula C23H26F2O3 and a molecular weight of 388.45 g/mol. Its IUPAC name is (2E,4E)-5-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid;ethane.
| Compound Name | (2E,4E)-5-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid;ethane |
|---|---|
| PubChem CID | 145171203 |
| Molecular Formula | C23H26F2O3 |
| Molecular Weight | 388.45 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | (2E,4E)-5-[2-[(E)-2-(3,5-difluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid;ethane |
| SMILES | CC.CC(/C=C/C1C(/C=C/c2cc(F)cc(F)c2)=CC(=O)CC1C)=C\C(=O)O |
| InChI | InChI=1S/C21H20F2O3.C2H6/c1-13(7-21(25)26)3-6-20-14(2)8-19(24)11-16(20)5-4-15-9-17(22)12-18(23)10-15;1-2/h3-7,9-12,14,20H,8H2,1-2H3,(H,25,26);1-2H3/b5-4+,6-3+,13-7+; |
| InChIKey | AQXANWJKUZARSD-POTWTDAZSA-N |
| XLogP | 5.74 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.45 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|