C21H21FO3 — CID 145171222
(2E,4E)-5-[2-[(E)-2-(3-fluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid (PubChem CID 145171222) has the molecular formula C21H21FO3 and a molecular weight of 340.39 g/mol. Its IUPAC name is (2E,4E)-5-[2-[(E)-2-(3-fluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid.
| Compound Name | (2E,4E)-5-[2-[(E)-2-(3-fluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 145171222 |
| Molecular Formula | C21H21FO3 |
| Molecular Weight | 340.39 g/mol |
| Exact Mass | 340.15 |
| IUPAC Name | (2E,4E)-5-[2-[(E)-2-(3-fluorophenyl)ethenyl]-6-methyl-4-oxocyclohex-2-en-1-yl]-3-methylpenta-2,4-dienoic acid |
| SMILES | CC(/C=C/C1C(/C=C/c2cccc(F)c2)=CC(=O)CC1C)=C\C(=O)O |
| InChI | InChI=1S/C21H21FO3/c1-14(10-21(24)25)6-9-20-15(2)11-19(23)13-17(20)8-7-16-4-3-5-18(22)12-16/h3-10,12-13,15,20H,11H2,1-2H3,(H,24,25)/b8-7+,9-6+,14-10+ |
| InChIKey | KRGWHIZQUYMZSL-ZOLDFYTJSA-N |
| XLogP | 4.58 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.39 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|