C21H23NO3 — CID 145171230
methyl (2Z,4E)-3-methyl-5-[6-methyl-4-oxo-2-[(E)-2-pyridin-3-ylethenyl]cyclohex-2-en-1-yl]penta-2,4-dienoate (PubChem CID 145171230) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is methyl (2Z,4E)-3-methyl-5-[6-methyl-4-oxo-2-[(E)-2-pyridin-3-ylethenyl]cyclohex-2-en-1-yl]penta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-3-methyl-5-[6-methyl-4-oxo-2-[(E)-2-pyridin-3-ylethenyl]cyclohex-2-en-1-yl]penta-2,4-dienoate |
|---|---|
| PubChem CID | 145171230 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | methyl (2Z,4E)-3-methyl-5-[6-methyl-4-oxo-2-[(E)-2-pyridin-3-ylethenyl]cyclohex-2-en-1-yl]penta-2,4-dienoate |
| SMILES | COC(=O)/C=C(C)\C=C\C1C(/C=C/c2cccnc2)=CC(=O)CC1C |
| InChI | InChI=1S/C21H23NO3/c1-15(11-21(24)25-3)6-9-20-16(2)12-19(23)13-18(20)8-7-17-5-4-10-22-14-17/h4-11,13-14,16,20H,12H2,1-3H3/b8-7+,9-6+,15-11- |
| InChIKey | WBOSJUFAEUWXAO-UMYLZNCPSA-N |
| XLogP | 3.92 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|