About (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine
(2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine (PubChem CID 145171343) has the molecular formula C9H14FN
and a molecular weight of 155.22 g/mol. Its IUPAC name is (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine.
Molecular Properties
| Compound Name | (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine |
| PubChem CID | 145171343 |
| Molecular Formula | C9H14FN |
| Molecular Weight | 155.22 g/mol |
| Exact Mass | 155.11 |
| IUPAC Name | (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine |
| SMILES | C=C/C(=C\C=C(/C)F)CNC |
| InChI | InChI=1S/C9H14FN/c1-4-9(7-11-3)6-5-8(2)10/h4-6,11H,1,7H2,2-3H3/b8-5+,9-6+ |
| InChIKey | MWMOHVZXUDUUSQ-XVYDYJIPSA-N |
| XLogP | 2.19 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 155.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine?
The IUPAC name of (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine (CID 145171343) is (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine.
What is the SMILES notation for (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine?
The canonical SMILES for (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine is C=C/C(=C\C=C(/C)F)CNC.
What is the InChIKey of (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine?
The InChIKey is MWMOHVZXUDUUSQ-XVYDYJIPSA-N. The full InChI is InChI=1S/C9H14FN/c1-4-9(7-11-3)6-5-8(2)10/h4-6,11H,1,7H2,2-3H3/b8-5+,9-6+.
What are the key properties of (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine?
(2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine has a molecular weight of 155.22 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-2-ethenyl-5-fluoro-N-methylhexa-2,4-dien-1-amine is sourced from PubChem (CID 145171343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).