C29H34F2N4O — CID 145171944
benzene;1-[(4,4-difluorocyclohexyl)methyl]-4-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyridin-2-one;ethane (PubChem CID 145171944) has the molecular formula C29H34F2N4O and a molecular weight of 492.61 g/mol. Its IUPAC name is benzene;1-[(4,4-difluorocyclohexyl)methyl]-4-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyridin-2-one;ethane.
| Compound Name | benzene;1-[(4,4-difluorocyclohexyl)methyl]-4-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyridin-2-one;ethane |
|---|---|
| PubChem CID | 145171944 |
| Molecular Formula | C29H34F2N4O |
| Molecular Weight | 492.61 g/mol |
| Exact Mass | 492.27 |
| IUPAC Name | benzene;1-[(4,4-difluorocyclohexyl)methyl]-4-(2,7,12-triazatricyclo[6.4.0.02,6]dodeca-1(8),6,9,11-tetraen-11-yl)pyridin-2-one;ethane |
| SMILES | CC.O=c1cc(-c2ccc3nc4n(c3n2)CCC4)ccn1CC1CCC(F)(F)CC1.c1ccccc1 |
| InChI | InChI=1S/C21H22F2N4O.C6H6.C2H6/c22-21(23)8-5-14(6-9-21)13-26-11-7-15(12-19(26)28)16-3-4-17-20(25-16)27-10-1-2-18(27)24-17;1-2-4-6-5-3-1;1-2/h3-4,7,11-12,14H,1-2,5-6,8-10,13H2;1-6H;1-2H3 |
| InChIKey | TWQWOENOLPSWFY-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 52.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.61 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |