C16H16Br2N2O — CID 145171962
benzene;N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine (PubChem CID 145171962) has the molecular formula C16H16Br2N2O and a molecular weight of 412.13 g/mol. Its IUPAC name is benzene;N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine.
| Compound Name | benzene;N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
|---|---|
| PubChem CID | 145171962 |
| Molecular Formula | C16H16Br2N2O |
| Molecular Weight | 412.13 g/mol |
| Exact Mass | 409.96 |
| IUPAC Name | benzene;N-(2,4-dibromophenyl)-3,6-dihydro-2H-1,4-oxazin-5-amine |
| SMILES | Brc1ccc(NC2=NCCOC2)c(Br)c1.c1ccccc1 |
| InChI | InChI=1S/C10H10Br2N2O.C6H6/c11-7-1-2-9(8(12)5-7)14-10-6-15-4-3-13-10;1-2-4-6-5-3-1/h1-2,5H,3-4,6H2,(H,13,14);1-6H |
| InChIKey | IODSNONTWSWNOY-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.13 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |