About (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine
(3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine (PubChem CID 145171971) has the molecular formula C17H14Br2FNO
and a molecular weight of 427.11 g/mol. Its IUPAC name is (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine.
Molecular Properties
| Compound Name | (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine |
| PubChem CID | 145171971 |
| Molecular Formula | C17H14Br2FNO |
| Molecular Weight | 427.11 g/mol |
| Exact Mass | 424.94 |
| IUPAC Name | (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine |
| SMILES | Fc1ccccc1C1COC/C(=C/c2ccc(Br)cc2Br)N1 |
| InChI | InChI=1S/C17H14Br2FNO/c18-12-6-5-11(15(19)8-12)7-13-9-22-10-17(21-13)14-3-1-2-4-16(14)20/h1-8,17,21H,9-10H2/b13-7- |
| InChIKey | DJKGRLYHKQXTBK-QPEQYQDCSA-N |
| XLogP | 5.05 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 427.11 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine?
The IUPAC name of (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine (CID 145171971) is (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine.
What is the SMILES notation for (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine?
The canonical SMILES for (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine is Fc1ccccc1C1COC/C(=C/c2ccc(Br)cc2Br)N1.
What is the InChIKey of (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine?
The InChIKey is DJKGRLYHKQXTBK-QPEQYQDCSA-N. The full InChI is InChI=1S/C17H14Br2FNO/c18-12-6-5-11(15(19)8-12)7-13-9-22-10-17(21-13)14-3-1-2-4-16(14)20/h1-8,17,21H,9-10H2/b13-7-.
What are the key properties of (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine?
(3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine has a molecular weight of 427.11 g/mol, XLogP of 5.05, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-3-[(2,4-dibromophenyl)methylidene]-5-(2-fluorophenyl)morpholine is sourced from PubChem (CID 145171971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).