About ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone
ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone (PubChem CID 145172083) has the molecular formula C21H33N3O2
and a molecular weight of 359.51 g/mol. Its IUPAC name is ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone.
Molecular Properties
| Compound Name | ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone |
| PubChem CID | 145172083 |
| Molecular Formula | C21H33N3O2 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.26 |
| IUPAC Name | ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone |
| SMILES | CC.CC.CN1C=CN(C(=O)N2CC3(CCOCC3)c3ccccc32)C1 |
| InChI | InChI=1S/C17H21N3O2.2C2H6/c1-18-8-9-19(13-18)16(21)20-12-17(6-10-22-11-7-17)14-4-2-3-5-15(14)20;2*1-2/h2-5,8-9H,6-7,10-13H2,1H3;2*1-2H3 |
| InChIKey | MOQMRPMBCKEIAZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 36.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The IUPAC name of ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone (CID 145172083) is ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone.
What is the SMILES notation for ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The canonical SMILES for ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone is CC.CC.CN1C=CN(C(=O)N2CC3(CCOCC3)c3ccccc32)C1.
What is the InChIKey of ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
The InChIKey is MOQMRPMBCKEIAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O2.2C2H6/c1-18-8-9-19(13-18)16(21)20-12-17(6-10-22-11-7-17)14-4-2-3-5-15(14)20;2*1-2/h2-5,8-9H,6-7,10-13H2,1H3;2*1-2H3.
What are the key properties of ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone?
ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone has a molecular weight of 359.51 g/mol, XLogP of 4.40, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(3-methyl-2H-imidazol-1-yl)-spiro[2H-indole-3,4'-oxane]-1-ylmethanone is sourced from PubChem (CID 145172083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).