About N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide
N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide (PubChem CID 145172102) has the molecular formula C9H15NO
and a molecular weight of 153.22 g/mol. Its IUPAC name is N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide |
| PubChem CID | 145172102 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide |
| SMILES | CC(C)=C/C(C)=C\N(C)C=O |
| InChI | InChI=1S/C9H15NO/c1-8(2)5-9(3)6-10(4)7-11/h5-7H,1-4H3/b9-6- |
| InChIKey | MMZLPFGGMQPZAU-TWGQIWQCSA-N |
| XLogP | 1.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide?
The IUPAC name of N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide (CID 145172102) is N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide.
What is the SMILES notation for N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide?
The canonical SMILES for N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide is CC(C)=C/C(C)=C\N(C)C=O.
What is the InChIKey of N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide?
The InChIKey is MMZLPFGGMQPZAU-TWGQIWQCSA-N. The full InChI is InChI=1S/C9H15NO/c1-8(2)5-9(3)6-10(4)7-11/h5-7H,1-4H3/b9-6-.
What are the key properties of N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide?
N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide has a molecular weight of 153.22 g/mol, XLogP of 1.94, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1Z)-2,4-dimethylpenta-1,3-dienyl]-N-methylformamide is sourced from PubChem (CID 145172102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).