C11H11FN2 — CID 145172215
7-fluoro-2,4-dimethylisoquinolin-1-imine (PubChem CID 145172215) has the molecular formula C11H11FN2 and a molecular weight of 190.22 g/mol. Its IUPAC name is 7-fluoro-2,4-dimethylisoquinolin-1-imine.
| Compound Name | 7-fluoro-2,4-dimethylisoquinolin-1-imine |
|---|---|
| PubChem CID | 145172215 |
| Molecular Formula | C11H11FN2 |
| Molecular Weight | 190.22 g/mol |
| Exact Mass | 190.09 |
| IUPAC Name | 7-fluoro-2,4-dimethylisoquinolin-1-imine |
| SMILES | [H]/N=c1/c2cc(F)ccc2c(C)cn1C |
| InChI | InChI=1S/C11H11FN2/c1-7-6-14(2)11(13)10-5-8(12)3-4-9(7)10/h3-6,13H,1-2H3/b13-11- |
| InChIKey | MOTVDCGSGXAJCY-QBFSEMIESA-N |
| XLogP | 2.11 |
| TPSA | 28.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.22 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |