About methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine
methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine (PubChem CID 145172342) has the molecular formula C11H17N3O4S
and a molecular weight of 287.34 g/mol. Its IUPAC name is methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine.
Molecular Properties
| Compound Name | methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine |
| PubChem CID | 145172342 |
| Molecular Formula | C11H17N3O4S |
| Molecular Weight | 287.34 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine |
| SMILES | C1COCCN1.COC(=O)c1cnc(SC)[nH]c1=O |
| InChI | InChI=1S/C7H8N2O3S.C4H9NO/c1-12-6(11)4-3-8-7(13-2)9-5(4)10;1-3-6-4-2-5-1/h3H,1-2H3,(H,8,9,10);5H,1-4H2 |
| InChIKey | YKPQCINOYOSNCU-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 93.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.34 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine?
The IUPAC name of methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine (CID 145172342) is methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine.
What is the SMILES notation for methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine?
The canonical SMILES for methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine is C1COCCN1.COC(=O)c1cnc(SC)[nH]c1=O.
What is the InChIKey of methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine?
The InChIKey is YKPQCINOYOSNCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O3S.C4H9NO/c1-12-6(11)4-3-8-7(13-2)9-5(4)10;1-3-6-4-2-5-1/h3H,1-2H3,(H,8,9,10);5H,1-4H2.
What are the key properties of methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine?
methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine has a molecular weight of 287.34 g/mol, XLogP of -0.12, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methylsulfanyl-6-oxo-1H-pyrimidine-5-carboxylate;morpholine is sourced from PubChem (CID 145172342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).