C17H19ClFN3O3S2 — CID 14517290
ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate (PubChem CID 14517290) has the molecular formula C17H19ClFN3O3S2 and a molecular weight of 431.94 g/mol. Its IUPAC name is ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate.
| Compound Name | ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate |
|---|---|
| PubChem CID | 14517290 |
| Molecular Formula | C17H19ClFN3O3S2 |
| Molecular Weight | 431.94 g/mol |
| Exact Mass | 431.05 |
| IUPAC Name | ethyl 2-[2-chloro-4-fluoro-5-[(3-oxo-5,6,7,8-tetrahydro-[1,3,4]thiadiazolo[3,4-a]pyridazin-1-ylidene)amino]phenyl]sulfanylpropanoate |
| SMILES | CCOC(=O)C(C)Sc1cc(/N=c2\sc(=O)n3n2CCCC3)c(F)cc1Cl |
| InChI | InChI=1S/C17H19ClFN3O3S2/c1-3-25-15(23)10(2)26-14-9-13(12(19)8-11(14)18)20-16-21-6-4-5-7-22(21)17(24)27-16/h8-10H,3-7H2,1-2H3/b20-16- |
| InChIKey | HAUNQPVXPNSSFA-SILNSSARSA-N |
| XLogP | 3.57 |
| TPSA | 65.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.94 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |