C18H34S — CID 145173584
9-ethyl-3,3,7,9-tetramethyl-2,4,4a,5,6,8,10,10a-octahydro-1H-benzo[8]annulene-7-thiol (PubChem CID 145173584) has the molecular formula C18H34S and a molecular weight of 282.54 g/mol. Its IUPAC name is 9-ethyl-3,3,7,9-tetramethyl-2,4,4a,5,6,8,10,10a-octahydro-1H-benzo[8]annulene-7-thiol.
| Compound Name | 9-ethyl-3,3,7,9-tetramethyl-2,4,4a,5,6,8,10,10a-octahydro-1H-benzo[8]annulene-7-thiol |
|---|---|
| PubChem CID | 145173584 |
| Molecular Formula | C18H34S |
| Molecular Weight | 282.54 g/mol |
| Exact Mass | 282.24 |
| IUPAC Name | 9-ethyl-3,3,7,9-tetramethyl-2,4,4a,5,6,8,10,10a-octahydro-1H-benzo[8]annulene-7-thiol |
| SMILES | CCC1(C)CC2CCC(C)(C)CC2CCC(C)(S)C1 |
| InChI | InChI=1S/C18H34S/c1-6-17(4)12-15-7-9-16(2,3)11-14(15)8-10-18(5,19)13-17/h14-15,19H,6-13H2,1-5H3 |
| InChIKey | NASBLDJPQLXVGV-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.54 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|