C13H12F4N2O — CID 145173612
1-[(2E,3E,5Z)-2-ethylidene-4,5,6-trifluorohexa-3,5-dienyl]-5-fluoro-2-methylpyrimidin-4-one (PubChem CID 145173612) has the molecular formula C13H12F4N2O and a molecular weight of 288.24 g/mol. Its IUPAC name is 1-[(2E,3E,5Z)-2-ethylidene-4,5,6-trifluorohexa-3,5-dienyl]-5-fluoro-2-methylpyrimidin-4-one.
| Compound Name | 1-[(2E,3E,5Z)-2-ethylidene-4,5,6-trifluorohexa-3,5-dienyl]-5-fluoro-2-methylpyrimidin-4-one |
|---|---|
| PubChem CID | 145173612 |
| Molecular Formula | C13H12F4N2O |
| Molecular Weight | 288.24 g/mol |
| Exact Mass | 288.09 |
| IUPAC Name | 1-[(2E,3E,5Z)-2-ethylidene-4,5,6-trifluorohexa-3,5-dienyl]-5-fluoro-2-methylpyrimidin-4-one |
| SMILES | C/C=C(\C=C(F)/C(F)=C/F)Cn1cc(F)c(=O)nc1C |
| InChI | InChI=1S/C13H12F4N2O/c1-3-9(4-10(15)11(16)5-14)6-19-7-12(17)13(20)18-8(19)2/h3-5,7H,6H2,1-2H3/b9-3+,10-4+,11-5- |
| InChIKey | MQAPRUVGINAGCW-CCNMPZDESA-N |
| XLogP | 3.27 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.24 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|