C13H16F2N2O3 — CID 145173806
ethyl (E)-2-carbamoyl-3-[(4,5-difluorocyclohexa-1,5-dien-1-yl)methylamino]prop-2-enoate (PubChem CID 145173806) has the molecular formula C13H16F2N2O3 and a molecular weight of 286.28 g/mol. Its IUPAC name is ethyl (E)-2-carbamoyl-3-[(4,5-difluorocyclohexa-1,5-dien-1-yl)methylamino]prop-2-enoate.
| Compound Name | ethyl (E)-2-carbamoyl-3-[(4,5-difluorocyclohexa-1,5-dien-1-yl)methylamino]prop-2-enoate |
|---|---|
| PubChem CID | 145173806 |
| Molecular Formula | C13H16F2N2O3 |
| Molecular Weight | 286.28 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | ethyl (E)-2-carbamoyl-3-[(4,5-difluorocyclohexa-1,5-dien-1-yl)methylamino]prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/NCC1=CCC(F)C(F)=C1)C(N)=O |
| InChI | InChI=1S/C13H16F2N2O3/c1-2-20-13(19)9(12(16)18)7-17-6-8-3-4-10(14)11(15)5-8/h3,5,7,10,17H,2,4,6H2,1H3,(H2,16,18)/b9-7+ |
| InChIKey | POVGXWOLNCLNDI-VQHVLOKHSA-N |
| XLogP | 1.03 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.28 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|