About (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide
(E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide (PubChem CID 145174007) has the molecular formula C11H11F3N2O2
and a molecular weight of 260.21 g/mol. Its IUPAC name is (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide.
Molecular Properties
| Compound Name | (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide |
| PubChem CID | 145174007 |
| Molecular Formula | C11H11F3N2O2 |
| Molecular Weight | 260.21 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide |
| SMILES | CO/C(=C/NCc1cc(F)c(F)c(F)c1)C(N)=O |
| InChI | InChI=1S/C11H11F3N2O2/c1-18-9(11(15)17)5-16-4-6-2-7(12)10(14)8(13)3-6/h2-3,5,16H,4H2,1H3,(H2,15,17)/b9-5+ |
| InChIKey | WWDPUVARPNTBTG-WEVVVXLNSA-N |
| XLogP | 1.17 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.21 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide?
The IUPAC name of (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide (CID 145174007) is (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide.
What is the SMILES notation for (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide?
The canonical SMILES for (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide is CO/C(=C/NCc1cc(F)c(F)c(F)c1)C(N)=O.
What is the InChIKey of (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide?
The InChIKey is WWDPUVARPNTBTG-WEVVVXLNSA-N. The full InChI is InChI=1S/C11H11F3N2O2/c1-18-9(11(15)17)5-16-4-6-2-7(12)10(14)8(13)3-6/h2-3,5,16H,4H2,1H3,(H2,15,17)/b9-5+.
What are the key properties of (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide?
(E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide has a molecular weight of 260.21 g/mol, XLogP of 1.17, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2-methoxy-3-[(3,4,5-trifluorophenyl)methylamino]prop-2-enamide is sourced from PubChem (CID 145174007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).