C5H5ClN2O2 — CID 145174009
2-chloro-5-(hydroxymethyl)-1H-pyrimidin-6-one (PubChem CID 145174009) has the molecular formula C5H5ClN2O2 and a molecular weight of 160.56 g/mol. Its IUPAC name is 2-chloro-5-(hydroxymethyl)-1H-pyrimidin-6-one.
| Compound Name | 2-chloro-5-(hydroxymethyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 145174009 |
| Molecular Formula | C5H5ClN2O2 |
| Molecular Weight | 160.56 g/mol |
| Exact Mass | 160.00 |
| IUPAC Name | 2-chloro-5-(hydroxymethyl)-1H-pyrimidin-6-one |
| SMILES | O=c1[nH]c(Cl)ncc1CO |
| InChI | InChI=1S/C5H5ClN2O2/c6-5-7-1-3(2-9)4(10)8-5/h1,9H,2H2,(H,7,8,10) |
| InChIKey | XGDJXIGNNXZSRM-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.56 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |