About ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate
ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate (PubChem CID 14517423) has the molecular formula C12H18N4O7S
and a molecular weight of 362.36 g/mol. Its IUPAC name is ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate.
Molecular Properties
| Compound Name | ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate |
| PubChem CID | 14517423 |
| Molecular Formula | C12H18N4O7S |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate |
| SMILES | CCOC(=O)C(C)S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C12H18N4O7S/c1-5-23-10(17)7(2)24(19,20)16-12(18)15-11-13-8(21-3)6-9(14-11)22-4/h6-7H,5H2,1-4H3,(H2,13,14,15,16,18) |
| InChIKey | IFDDRQTZSKJFKX-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate?
The IUPAC name of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate (CID 14517423) is ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate.
What is the SMILES notation for ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate?
The canonical SMILES for ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate is CCOC(=O)C(C)S(=O)(=O)NC(=O)Nc1nc(OC)cc(OC)n1.
What is the InChIKey of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate?
The InChIKey is IFDDRQTZSKJFKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N4O7S/c1-5-23-10(17)7(2)24(19,20)16-12(18)15-11-13-8(21-3)6-9(14-11)22-4/h6-7H,5H2,1-4H3,(H2,13,14,15,16,18).
What are the key properties of ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate?
ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate has a molecular weight of 362.36 g/mol, XLogP of -0.10, 7 rotatable bonds, 2 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(4,6-dimethoxypyrimidin-2-yl)carbamoylsulfamoyl]propanoate is sourced from PubChem (CID 14517423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).