C18H24Cl2N2O — CID 145174605
4,6-dichloro-1H-indole-2-carboxamide;1,1,3-trimethylcyclohexane (PubChem CID 145174605) has the molecular formula C18H24Cl2N2O and a molecular weight of 355.31 g/mol. Its IUPAC name is 4,6-dichloro-1H-indole-2-carboxamide;1,1,3-trimethylcyclohexane.
| Compound Name | 4,6-dichloro-1H-indole-2-carboxamide;1,1,3-trimethylcyclohexane |
|---|---|
| PubChem CID | 145174605 |
| Molecular Formula | C18H24Cl2N2O |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 354.13 |
| IUPAC Name | 4,6-dichloro-1H-indole-2-carboxamide;1,1,3-trimethylcyclohexane |
| SMILES | CC1CCCC(C)(C)C1.NC(=O)c1cc2c(Cl)cc(Cl)cc2[nH]1 |
| InChI | InChI=1S/C9H6Cl2N2O.C9H18/c10-4-1-6(11)5-3-8(9(12)14)13-7(5)2-4;1-8-5-4-6-9(2,3)7-8/h1-3,13H,(H2,12,14);8H,4-7H2,1-3H3 |
| InChIKey | VIKGGKAYBLPUGA-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |