C24H24N2O2S2 — CID 145175063
6,6-dimethyl-3-[7-(oxetan-3-yl)-8-prop-1-ynyldibenzothiophen-2-yl]-1-oxo-2,3-dihydro-1,4-thiazin-5-amine (PubChem CID 145175063) has the molecular formula C24H24N2O2S2 and a molecular weight of 436.60 g/mol. Its IUPAC name is 6,6-dimethyl-3-[7-(oxetan-3-yl)-8-prop-1-ynyldibenzothiophen-2-yl]-1-oxo-2,3-dihydro-1,4-thiazin-5-amine.
| Compound Name | 6,6-dimethyl-3-[7-(oxetan-3-yl)-8-prop-1-ynyldibenzothiophen-2-yl]-1-oxo-2,3-dihydro-1,4-thiazin-5-amine |
|---|---|
| PubChem CID | 145175063 |
| Molecular Formula | C24H24N2O2S2 |
| Molecular Weight | 436.60 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 6,6-dimethyl-3-[7-(oxetan-3-yl)-8-prop-1-ynyldibenzothiophen-2-yl]-1-oxo-2,3-dihydro-1,4-thiazin-5-amine |
| SMILES | CC#Cc1cc2c(cc1C1COC1)sc1ccc(C3CS(=O)C(C)(C)C(N)=N3)cc12 |
| InChI | InChI=1S/C24H24N2O2S2/c1-4-5-14-8-19-18-9-15(20-13-30(27)24(2,3)23(25)26-20)6-7-21(18)29-22(19)10-17(14)16-11-28-12-16/h6-10,16,20H,11-13H2,1-3H3,(H2,25,26) |
| InChIKey | HVJOCDLSOVYVPM-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.60 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|