C24H16F5N3O3 — CID 145175399
3-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide (PubChem CID 145175399) has the molecular formula C24H16F5N3O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is 3-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide.
| Compound Name | 3-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
|---|---|
| PubChem CID | 145175399 |
| Molecular Formula | C24H16F5N3O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.11 |
| IUPAC Name | 3-(3,5-difluorophenyl)-2-(1,3-dioxoisoindol-2-yl)-N-methyl-N-[6-(trifluoromethyl)-3-pyridinyl]propanamide |
| SMILES | CN(C(=O)C(Cc1cc(F)cc(F)c1)N1C(=O)c2ccccc2C1=O)c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C24H16F5N3O3/c1-31(16-6-7-20(30-12-16)24(27,28)29)23(35)19(10-13-8-14(25)11-15(26)9-13)32-21(33)17-4-2-3-5-18(17)22(32)34/h2-9,11-12,19H,10H2,1H3 |
| InChIKey | HDTOVONKPGWIFE-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|