C41H45N5O6 — CID 145175953
4-methoxy-N,N-dimethylaniline;6-N-[2-(4-methoxy-N-methylanilino)-2-oxo-1-phenylethyl]-2-N-(2-oxoethyl)pyridine-2,6-dicarboxamide;toluene (PubChem CID 145175953) has the molecular formula C41H45N5O6 and a molecular weight of 703.84 g/mol. Its IUPAC name is 4-methoxy-N,N-dimethylaniline;6-N-[2-(4-methoxy-N-methylanilino)-2-oxo-1-phenylethyl]-2-N-(2-oxoethyl)pyridine-2,6-dicarboxamide;toluene.
| Compound Name | 4-methoxy-N,N-dimethylaniline;6-N-[2-(4-methoxy-N-methylanilino)-2-oxo-1-phenylethyl]-2-N-(2-oxoethyl)pyridine-2,6-dicarboxamide;toluene |
|---|---|
| PubChem CID | 145175953 |
| Molecular Formula | C41H45N5O6 |
| Molecular Weight | 703.84 g/mol |
| Exact Mass | 703.34 |
| IUPAC Name | 4-methoxy-N,N-dimethylaniline;6-N-[2-(4-methoxy-N-methylanilino)-2-oxo-1-phenylethyl]-2-N-(2-oxoethyl)pyridine-2,6-dicarboxamide;toluene |
| SMILES | COc1ccc(N(C)C(=O)C(NC(=O)c2cccc(C(=O)NCC=O)n2)c2ccccc2)cc1.COc1ccc(N(C)C)cc1.Cc1ccccc1 |
| InChI | InChI=1S/C25H24N4O5.C9H13NO.C7H8/c1-29(18-11-13-19(34-2)14-12-18)25(33)22(17-7-4-3-5-8-17)28-24(32)21-10-6-9-20(27-21)23(31)26-15-16-30;1-10(2)8-4-6-9(11-3)7-5-8;1-7-5-3-2-4-6-7/h3-14,16,22H,15H2,1-2H3,(H,26,31)(H,28,32);4-7H,1-3H3;2-6H,1H3 |
| InChIKey | JZISUIBZSCCJCS-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 130.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.84 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|