C25H30N4OS — CID 145175986
(2S)-N-methyl-N,3-diphenyl-2-[[2-(1-phenylpropan-2-yl)hydrazinyl]sulfanylamino]propanamide (PubChem CID 145175986) has the molecular formula C25H30N4OS and a molecular weight of 434.61 g/mol. Its IUPAC name is (2S)-N-methyl-N,3-diphenyl-2-[[2-(1-phenylpropan-2-yl)hydrazinyl]sulfanylamino]propanamide.
| Compound Name | (2S)-N-methyl-N,3-diphenyl-2-[[2-(1-phenylpropan-2-yl)hydrazinyl]sulfanylamino]propanamide |
|---|---|
| PubChem CID | 145175986 |
| Molecular Formula | C25H30N4OS |
| Molecular Weight | 434.61 g/mol |
| Exact Mass | 434.21 |
| IUPAC Name | (2S)-N-methyl-N,3-diphenyl-2-[[2-(1-phenylpropan-2-yl)hydrazinyl]sulfanylamino]propanamide |
| SMILES | CC(Cc1ccccc1)NNSN[C@@H](Cc1ccccc1)C(=O)N(C)c1ccccc1 |
| InChI | InChI=1S/C25H30N4OS/c1-20(18-21-12-6-3-7-13-21)26-28-31-27-24(19-22-14-8-4-9-15-22)25(30)29(2)23-16-10-5-11-17-23/h3-17,20,24,26-28H,18-19H2,1-2H3/t20?,24-/m0/s1 |
| InChIKey | NJZFHJWUZMNOJX-JWIMYKKASA-N |
| XLogP | 4.14 |
| TPSA | 56.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.61 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|