About N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide
N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide (PubChem CID 145176136) has the molecular formula C9H13NO2
and a molecular weight of 167.21 g/mol. Its IUPAC name is N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide.
Molecular Properties
| Compound Name | N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide |
| PubChem CID | 145176136 |
| Molecular Formula | C9H13NO2 |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.09 |
| IUPAC Name | N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide |
| SMILES | C=C(/C=C\C(=C)N(C)C=O)OC |
| InChI | InChI=1S/C9H13NO2/c1-8(10(3)7-11)5-6-9(2)12-4/h5-7H,1-2H2,3-4H3/b6-5- |
| InChIKey | IBCXWRLIEHIMEL-WAYWQWQTSA-N |
| XLogP | 1.30 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide?
The IUPAC name of N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide (CID 145176136) is N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide.
What is the SMILES notation for N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide?
The canonical SMILES for N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide is C=C(/C=C\C(=C)N(C)C=O)OC.
What is the InChIKey of N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide?
The InChIKey is IBCXWRLIEHIMEL-WAYWQWQTSA-N. The full InChI is InChI=1S/C9H13NO2/c1-8(10(3)7-11)5-6-9(2)12-4/h5-7H,1-2H2,3-4H3/b6-5-.
What are the key properties of N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide?
N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide has a molecular weight of 167.21 g/mol, XLogP of 1.30, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(3Z)-5-methoxyhexa-1,3,5-trien-2-yl]-N-methylformamide is sourced from PubChem (CID 145176136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).