About [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid
[(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid (PubChem CID 145176242) has the molecular formula C22H36N2O2
and a molecular weight of 360.54 g/mol. Its IUPAC name is [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid.
Molecular Properties
| Compound Name | [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid |
| PubChem CID | 145176242 |
| Molecular Formula | C22H36N2O2 |
| Molecular Weight | 360.54 g/mol |
| Exact Mass | 360.28 |
| IUPAC Name | [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid |
| SMILES | C/C=C\c1ccccc1.CCCNC1CCC(NCCCC(=O)O)CC1 |
| InChI | InChI=1S/C13H26N2O2.C9H10/c1-2-9-14-11-5-7-12(8-6-11)15-10-3-4-13(16)17;1-2-6-9-7-4-3-5-8-9/h11-12,14-15H,2-10H2,1H3,(H,16,17);2-8H,1H3/b;6-2- |
| InChIKey | WRYFVJBPEOEQLT-MKSBNHLASA-N |
| XLogP | 4.47 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 360.54 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid?
The IUPAC name of [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid (CID 145176242) is [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid.
What is the SMILES notation for [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid?
The canonical SMILES for [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid is C/C=C\c1ccccc1.CCCNC1CCC(NCCCC(=O)O)CC1.
What is the InChIKey of [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid?
The InChIKey is WRYFVJBPEOEQLT-MKSBNHLASA-N. The full InChI is InChI=1S/C13H26N2O2.C9H10/c1-2-9-14-11-5-7-12(8-6-11)15-10-3-4-13(16)17;1-2-6-9-7-4-3-5-8-9/h11-12,14-15H,2-10H2,1H3,(H,16,17);2-8H,1H3/b;6-2-.
What are the key properties of [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid?
[(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid has a molecular weight of 360.54 g/mol, XLogP of 4.47, 9 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-prop-1-enyl]benzene;4-[[4-(propylamino)cyclohexyl]amino]butanoic acid is sourced from PubChem (CID 145176242), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).