C23H20ClF6N3O2 — CID 145178296
ethyl 2-chloro-5-[4-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)-2,6-dimethylphenyl]pyrazol-1-yl]pyridine-3-carboxylate (PubChem CID 145178296) has the molecular formula C23H20ClF6N3O2 and a molecular weight of 519.87 g/mol. Its IUPAC name is ethyl 2-chloro-5-[4-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)-2,6-dimethylphenyl]pyrazol-1-yl]pyridine-3-carboxylate.
| Compound Name | ethyl 2-chloro-5-[4-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)-2,6-dimethylphenyl]pyrazol-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 145178296 |
| Molecular Formula | C23H20ClF6N3O2 |
| Molecular Weight | 519.87 g/mol |
| Exact Mass | 519.11 |
| IUPAC Name | ethyl 2-chloro-5-[4-[4-(1,1,1,2,3,3-hexafluorobutan-2-yl)-2,6-dimethylphenyl]pyrazol-1-yl]pyridine-3-carboxylate |
| SMILES | CCOC(=O)c1cc(-n2cc(-c3c(C)cc(C(F)(C(C)(F)F)C(F)(F)F)cc3C)cn2)cnc1Cl |
| InChI | InChI=1S/C23H20ClF6N3O2/c1-5-35-20(34)17-8-16(10-31-19(17)24)33-11-14(9-32-33)18-12(2)6-15(7-13(18)3)22(27,21(4,25)26)23(28,29)30/h6-11H,5H2,1-4H3 |
| InChIKey | UDLUDZCUKILSOT-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.87 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|