About 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane
7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane (PubChem CID 145179456) has the molecular formula C16H16F2S
and a molecular weight of 278.37 g/mol. Its IUPAC name is 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane.
Molecular Properties
| Compound Name | 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane |
| PubChem CID | 145179456 |
| Molecular Formula | C16H16F2S |
| Molecular Weight | 278.37 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane |
| SMILES | CC.Fc1ccc2c(c1F)CSc1ccccc1C2 |
| InChI | InChI=1S/C14H10F2S.C2H6/c15-12-6-5-9-7-10-3-1-2-4-13(10)17-8-11(9)14(12)16;1-2/h1-6H,7-8H2;1-2H3 |
| InChIKey | GWMOHUMSPWIICO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 278.37 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane?
The IUPAC name of 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane (CID 145179456) is 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane.
What is the SMILES notation for 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane?
The canonical SMILES for 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane is CC.Fc1ccc2c(c1F)CSc1ccccc1C2.
What is the InChIKey of 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane?
The InChIKey is GWMOHUMSPWIICO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10F2S.C2H6/c15-12-6-5-9-7-10-3-1-2-4-13(10)17-8-11(9)14(12)16;1-2/h1-6H,7-8H2;1-2H3.
What are the key properties of 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane?
7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane has a molecular weight of 278.37 g/mol, XLogP of 5.19, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7,8-difluoro-6,11-dihydrobenzo[c][1]benzothiepine;ethane is sourced from PubChem (CID 145179456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).