C25H24F3N11O — CID 145179604
6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-N-imidazo[1,2-a]pyridin-7-yl-2-N-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine (PubChem CID 145179604) has the molecular formula C25H24F3N11O and a molecular weight of 551.54 g/mol. Its IUPAC name is 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-N-imidazo[1,2-a]pyridin-7-yl-2-N-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-N-imidazo[1,2-a]pyridin-7-yl-2-N-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 145179604 |
| Molecular Formula | C25H24F3N11O |
| Molecular Weight | 551.54 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | 6-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-4-N-imidazo[1,2-a]pyridin-7-yl-2-N-[3-(1,2,4-triazol-1-yl)-5-(trifluoromethyl)phenyl]-1,3,5-triazine-2,4-diamine |
| SMILES | C[C@@H]1CN(c2nc(Nc3cc(-n4cncn4)cc(C(F)(F)F)c3)nc(Nc3ccn4ccnc4c3)n2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H24F3N11O/c1-15-11-38(12-16(2)40-15)24-35-22(32-18-3-5-37-6-4-30-21(37)10-18)34-23(36-24)33-19-7-17(25(26,27)28)8-20(9-19)39-14-29-13-31-39/h3-10,13-16H,11-12H2,1-2H3,(H2,32,33,34,35,36)/t15-,16+ |
| InChIKey | GKXSKUTVZPECQL-IYBDPMFKSA-N |
| XLogP | 4.22 |
| TPSA | 123.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.54 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |