About ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile
ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile (PubChem CID 145180646) has the molecular formula C16H17FN2
and a molecular weight of 256.32 g/mol. Its IUPAC name is ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile.
Molecular Properties
| Compound Name | ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile |
| PubChem CID | 145180646 |
| Molecular Formula | C16H17FN2 |
| Molecular Weight | 256.32 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile |
| SMILES | C=C(/C=C\C(C#N)=C/C)c1ccc(F)cc1.C=CN |
| InChI | InChI=1S/C14H12FN.C2H5N/c1-3-12(10-16)5-4-11(2)13-6-8-14(15)9-7-13;1-2-3/h3-9H,2H2,1H3;2H,1,3H2/b5-4-,12-3+; |
| InChIKey | MSZWPGWQVCFYGB-BFGDLSKDSA-N |
| XLogP | 3.95 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.32 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile?
The IUPAC name of ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile (CID 145180646) is ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile.
What is the SMILES notation for ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile?
The canonical SMILES for ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile is C=C(/C=C\C(C#N)=C/C)c1ccc(F)cc1.C=CN.
What is the InChIKey of ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile?
The InChIKey is MSZWPGWQVCFYGB-BFGDLSKDSA-N. The full InChI is InChI=1S/C14H12FN.C2H5N/c1-3-12(10-16)5-4-11(2)13-6-8-14(15)9-7-13;1-2-3/h3-9H,2H2,1H3;2H,1,3H2/b5-4-,12-3+;.
What are the key properties of ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile?
ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile has a molecular weight of 256.32 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethenamine;(2E,3Z)-2-ethylidene-5-(4-fluorophenyl)hexa-3,5-dienenitrile is sourced from PubChem (CID 145180646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).