About (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid
(4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid (PubChem CID 145180717) has the molecular formula C13H15NO2S
and a molecular weight of 249.34 g/mol. Its IUPAC name is (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
Molecular Properties
| Compound Name | (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| PubChem CID | 145180717 |
| Molecular Formula | C13H15NO2S |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.08 |
| IUPAC Name | (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid |
| SMILES | Cc1ccc(C2=N[C@@](C)(C(=O)O)CS2)c(C)c1 |
| InChI | InChI=1S/C13H15NO2S/c1-8-4-5-10(9(2)6-8)11-14-13(3,7-17-11)12(15)16/h4-6H,7H2,1-3H3,(H,15,16)/t13-/m1/s1 |
| InChIKey | HNNNJMULQXHCOC-CYBMUJFWSA-N |
| XLogP | 2.64 |
| TPSA | 49.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
The IUPAC name of (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid (CID 145180717) is (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid.
What is the SMILES notation for (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
The canonical SMILES for (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid is Cc1ccc(C2=N[C@@](C)(C(=O)O)CS2)c(C)c1.
What is the InChIKey of (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
The InChIKey is HNNNJMULQXHCOC-CYBMUJFWSA-N. The full InChI is InChI=1S/C13H15NO2S/c1-8-4-5-10(9(2)6-8)11-14-13(3,7-17-11)12(15)16/h4-6H,7H2,1-3H3,(H,15,16)/t13-/m1/s1.
What are the key properties of (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid?
(4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid has a molecular weight of 249.34 g/mol, XLogP of 2.64, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-2-(2,4-dimethylphenyl)-4-methyl-5H-1,3-thiazole-4-carboxylic acid is sourced from PubChem (CID 145180717), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).