About 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline
2-(aminomethylsulfanyl)-4,5-dimethoxyaniline (PubChem CID 145180994) has the molecular formula C9H14N2O2S
and a molecular weight of 214.29 g/mol. Its IUPAC name is 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline.
Molecular Properties
| Compound Name | 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline |
| PubChem CID | 145180994 |
| Molecular Formula | C9H14N2O2S |
| Molecular Weight | 214.29 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline |
| SMILES | COc1cc(N)c(SCN)cc1OC |
| InChI | InChI=1S/C9H14N2O2S/c1-12-7-3-6(11)9(14-5-10)4-8(7)13-2/h3-4H,5,10-11H2,1-2H3 |
| InChIKey | BKODGOFJXWMAQD-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.29 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline?
The IUPAC name of 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline (CID 145180994) is 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline.
What is the SMILES notation for 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline?
The canonical SMILES for 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline is COc1cc(N)c(SCN)cc1OC.
What is the InChIKey of 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline?
The InChIKey is BKODGOFJXWMAQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2S/c1-12-7-3-6(11)9(14-5-10)4-8(7)13-2/h3-4H,5,10-11H2,1-2H3.
What are the key properties of 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline?
2-(aminomethylsulfanyl)-4,5-dimethoxyaniline has a molecular weight of 214.29 g/mol, XLogP of 1.29, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethylsulfanyl)-4,5-dimethoxyaniline is sourced from PubChem (CID 145180994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).