C30H48O7 — CID 145181452
ethane;methyl 2-[7-[(2E)-9-methyl-4-oxodeca-2,9-dienyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate (PubChem CID 145181452) has the molecular formula C30H48O7 and a molecular weight of 520.71 g/mol. Its IUPAC name is ethane;methyl 2-[7-[(2E)-9-methyl-4-oxodeca-2,9-dienyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate.
| Compound Name | ethane;methyl 2-[7-[(2E)-9-methyl-4-oxodeca-2,9-dienyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
|---|---|
| PubChem CID | 145181452 |
| Molecular Formula | C30H48O7 |
| Molecular Weight | 520.71 g/mol |
| Exact Mass | 520.34 |
| IUPAC Name | ethane;methyl 2-[7-[(2E)-9-methyl-4-oxodeca-2,9-dienyl]spiro[3,5,8,13-tetraoxatricyclo[7.4.0.02,6]tridecane-4,1'-cyclohexane]-12-yl]acetate |
| SMILES | C=C(C)CCCCC(=O)/C=C/CC1OC2CCC(CC(=O)OC)OC2C2OC3(CCCCC3)OC12.CC |
| InChI | InChI=1S/C28H42O7.C2H6/c1-19(2)10-5-6-11-20(29)12-9-13-22-26-27(35-28(34-26)16-7-4-8-17-28)25-23(33-22)15-14-21(32-25)18-24(30)31-3;1-2/h9,12,21-23,25-27H,1,4-8,10-11,13-18H2,2-3H3;1-2H3/b12-9+; |
| InChIKey | GJAFZCUKEMROLD-NBYYMMLRSA-N |
| XLogP | 5.99 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.71 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|