About N-methylacetamide;1H-1,2,4-triazole
N-methylacetamide;1H-1,2,4-triazole (PubChem CID 145181635) has the molecular formula C5H10N4O
and a molecular weight of 142.16 g/mol. Its IUPAC name is N-methylacetamide;1H-1,2,4-triazole.
Molecular Properties
| Compound Name | N-methylacetamide;1H-1,2,4-triazole |
| PubChem CID | 145181635 |
| Molecular Formula | C5H10N4O |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.09 |
| IUPAC Name | N-methylacetamide;1H-1,2,4-triazole |
| SMILES | CNC(C)=O.c1nc[nH]n1 |
| InChI | InChI=1S/C3H7NO.C2H3N3/c1-3(5)4-2;1-3-2-5-4-1/h1-2H3,(H,4,5);1-2H,(H,3,4,5) |
| InChIKey | ILWMIWKQWLZZBT-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methylacetamide;1H-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methylacetamide;1H-1,2,4-triazole?
The IUPAC name of N-methylacetamide;1H-1,2,4-triazole (CID 145181635) is N-methylacetamide;1H-1,2,4-triazole.
What is the SMILES notation for N-methylacetamide;1H-1,2,4-triazole?
The canonical SMILES for N-methylacetamide;1H-1,2,4-triazole is CNC(C)=O.c1nc[nH]n1.
What is the InChIKey of N-methylacetamide;1H-1,2,4-triazole?
The InChIKey is ILWMIWKQWLZZBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NO.C2H3N3/c1-3(5)4-2;1-3-2-5-4-1/h1-2H3,(H,4,5);1-2H,(H,3,4,5).
What are the key properties of N-methylacetamide;1H-1,2,4-triazole?
N-methylacetamide;1H-1,2,4-triazole has a molecular weight of 142.16 g/mol, XLogP of -0.44, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methylacetamide;1H-1,2,4-triazole is sourced from PubChem (CID 145181635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).