C11H16N4 — CID 145182664
ethane;1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene (PubChem CID 145182664) has the molecular formula C11H16N4 and a molecular weight of 204.28 g/mol. Its IUPAC name is ethane;1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene.
| Compound Name | ethane;1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
|---|---|
| PubChem CID | 145182664 |
| Molecular Formula | C11H16N4 |
| Molecular Weight | 204.28 g/mol |
| Exact Mass | 204.14 |
| IUPAC Name | ethane;1,4,8,13-tetrazatricyclo[7.4.0.02,7]trideca-2(7),8,10,12-tetraene |
| SMILES | CC.c1cnn2c3c(nc2c1)CCNC3 |
| InChI | InChI=1S/C9H10N4.C2H6/c1-2-9-12-7-3-5-10-6-8(7)13(9)11-4-1;1-2/h1-2,4,10H,3,5-6H2;1-2H3 |
| InChIKey | BXGLWZRTZHRSFP-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.28 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |