C16H13BrF2N2O — CID 145182731
2-bromo-1-[3-(2,6-difluorophenyl)-5,6,7,8-tetrahydrocinnolin-8-yl]ethanone (PubChem CID 145182731) has the molecular formula C16H13BrF2N2O and a molecular weight of 367.19 g/mol. Its IUPAC name is 2-bromo-1-[3-(2,6-difluorophenyl)-5,6,7,8-tetrahydrocinnolin-8-yl]ethanone.
| Compound Name | 2-bromo-1-[3-(2,6-difluorophenyl)-5,6,7,8-tetrahydrocinnolin-8-yl]ethanone |
|---|---|
| PubChem CID | 145182731 |
| Molecular Formula | C16H13BrF2N2O |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 366.02 |
| IUPAC Name | 2-bromo-1-[3-(2,6-difluorophenyl)-5,6,7,8-tetrahydrocinnolin-8-yl]ethanone |
| SMILES | O=C(CBr)C1CCCc2cc(-c3c(F)cccc3F)nnc21 |
| InChI | InChI=1S/C16H13BrF2N2O/c17-8-14(22)10-4-1-3-9-7-13(20-21-16(9)10)15-11(18)5-2-6-12(15)19/h2,5-7,10H,1,3-4,8H2 |
| InChIKey | AUQAANUSIKWBCB-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|