About N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine
N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine (PubChem CID 145183019) has the molecular formula C6H5BrN2S
and a molecular weight of 217.09 g/mol. Its IUPAC name is N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine.
Molecular Properties
| Compound Name | N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine |
| PubChem CID | 145183019 |
| Molecular Formula | C6H5BrN2S |
| Molecular Weight | 217.09 g/mol |
| Exact Mass | 215.94 |
| IUPAC Name | N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine |
| SMILES | C=Cc1nc(Br)sc1N=C |
| InChI | InChI=1S/C6H5BrN2S/c1-3-4-5(8-2)10-6(7)9-4/h3H,1-2H2 |
| InChIKey | WDUZCCRSODXKCQ-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.09 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine?
The IUPAC name of N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine (CID 145183019) is N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine.
What is the SMILES notation for N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine?
The canonical SMILES for N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine is C=Cc1nc(Br)sc1N=C.
What is the InChIKey of N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine?
The InChIKey is WDUZCCRSODXKCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5BrN2S/c1-3-4-5(8-2)10-6(7)9-4/h3H,1-2H2.
What are the key properties of N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine?
N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine has a molecular weight of 217.09 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-4-ethenyl-1,3-thiazol-5-yl)methanimine is sourced from PubChem (CID 145183019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).