C21H32N6O2 — CID 145183209
2-(methylamino)-N-pentan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide;1-piperidin-1-ylprop-2-en-1-one (PubChem CID 145183209) has the molecular formula C21H32N6O2 and a molecular weight of 400.53 g/mol. Its IUPAC name is 2-(methylamino)-N-pentan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide;1-piperidin-1-ylprop-2-en-1-one.
| Compound Name | 2-(methylamino)-N-pentan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide;1-piperidin-1-ylprop-2-en-1-one |
|---|---|
| PubChem CID | 145183209 |
| Molecular Formula | C21H32N6O2 |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.26 |
| IUPAC Name | 2-(methylamino)-N-pentan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide;1-piperidin-1-ylprop-2-en-1-one |
| SMILES | C=CC(=O)N1CCCCC1.CCCC(C)NC(=O)c1c[nH]c2ncc(NC)nc12 |
| InChI | InChI=1S/C13H19N5O.C8H13NO/c1-4-5-8(2)17-13(19)9-6-15-12-11(9)18-10(14-3)7-16-12;1-2-8(10)9-6-4-3-5-7-9/h6-8H,4-5H2,1-3H3,(H,14,18)(H,15,16)(H,17,19);2H,1,3-7H2 |
| InChIKey | WIONNKKSJAIIJM-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|