C13H19NO3 — CID 145183249
ethane;2-[(2S,3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid (PubChem CID 145183249) has the molecular formula C13H19NO3 and a molecular weight of 237.30 g/mol. Its IUPAC name is ethane;2-[(2S,3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid.
| Compound Name | ethane;2-[(2S,3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid |
|---|---|
| PubChem CID | 145183249 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethane;2-[(2S,3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid |
| SMILES | C=C/C=C1/C(=O)N[C@@H](CC(=O)O)/C1=C/C.CC |
| InChI | InChI=1S/C11H13NO3.C2H6/c1-3-5-8-7(4-2)9(6-10(13)14)12-11(8)15;1-2/h3-5,9H,1,6H2,2H3,(H,12,15)(H,13,14);1-2H3/b7-4+,8-5+;/t9-;/m0./s1 |
| InChIKey | CPGLTKMPTYYXFF-ASTMZWQZSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|