About ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid
ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid (PubChem CID 145183254) has the molecular formula C13H19NO3
and a molecular weight of 237.30 g/mol. Its IUPAC name is ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid.
Molecular Properties
| Compound Name | ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid |
| PubChem CID | 145183254 |
| Molecular Formula | C13H19NO3 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.14 |
| IUPAC Name | ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid |
| SMILES | C=C/C=C1/C(=O)NC(CC(=O)O)/C1=C/C.CC |
| InChI | InChI=1S/C11H13NO3.C2H6/c1-3-5-8-7(4-2)9(6-10(13)14)12-11(8)15;1-2/h3-5,9H,1,6H2,2H3,(H,12,15)(H,13,14);1-2H3/b7-4+,8-5+; |
| InChIKey | CPGLTKMPTYYXFF-JJHSXXHRSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid?
The IUPAC name of ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid (CID 145183254) is ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid.
What is the SMILES notation for ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid?
The canonical SMILES for ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid is C=C/C=C1/C(=O)NC(CC(=O)O)/C1=C/C.CC.
What is the InChIKey of ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid?
The InChIKey is CPGLTKMPTYYXFF-JJHSXXHRSA-N. The full InChI is InChI=1S/C11H13NO3.C2H6/c1-3-5-8-7(4-2)9(6-10(13)14)12-11(8)15;1-2/h3-5,9H,1,6H2,2H3,(H,12,15)(H,13,14);1-2H3/b7-4+,8-5+;.
What are the key properties of ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid?
ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid has a molecular weight of 237.30 g/mol, XLogP of 2.04, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[(3E,4E)-3-ethylidene-5-oxo-4-prop-2-enylidenepyrrolidin-2-yl]acetic acid is sourced from PubChem (CID 145183254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).