About 7-methyl-4-propyl-1,2-dihydronaphthalene
7-methyl-4-propyl-1,2-dihydronaphthalene (PubChem CID 145183913) has the molecular formula C14H18
and a molecular weight of 186.30 g/mol. Its IUPAC name is 7-methyl-4-propyl-1,2-dihydronaphthalene.
Molecular Properties
| Compound Name | 7-methyl-4-propyl-1,2-dihydronaphthalene |
| PubChem CID | 145183913 |
| Molecular Formula | C14H18 |
| Molecular Weight | 186.30 g/mol |
| Exact Mass | 186.14 |
| IUPAC Name | 7-methyl-4-propyl-1,2-dihydronaphthalene |
| SMILES | CCCC1=CCCc2cc(C)ccc21 |
| InChI | InChI=1S/C14H18/c1-3-5-12-6-4-7-13-10-11(2)8-9-14(12)13/h6,8-10H,3-5,7H2,1-2H3 |
| InChIKey | GAQGZHAFZQJYOQ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 7-methyl-4-propyl-1,2-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-4-propyl-1,2-dihydronaphthalene?
The IUPAC name of 7-methyl-4-propyl-1,2-dihydronaphthalene (CID 145183913) is 7-methyl-4-propyl-1,2-dihydronaphthalene.
What is the SMILES notation for 7-methyl-4-propyl-1,2-dihydronaphthalene?
The canonical SMILES for 7-methyl-4-propyl-1,2-dihydronaphthalene is CCCC1=CCCc2cc(C)ccc21.
What is the InChIKey of 7-methyl-4-propyl-1,2-dihydronaphthalene?
The InChIKey is GAQGZHAFZQJYOQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18/c1-3-5-12-6-4-7-13-10-11(2)8-9-14(12)13/h6,8-10H,3-5,7H2,1-2H3.
What are the key properties of 7-methyl-4-propyl-1,2-dihydronaphthalene?
7-methyl-4-propyl-1,2-dihydronaphthalene has a molecular weight of 186.30 g/mol, XLogP of 4.12, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-4-propyl-1,2-dihydronaphthalene is sourced from PubChem (CID 145183913), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).